Difference between revisions of "Large-branched-glucans"

Revision as of 08:28, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-18666 ==
+== Metabolite HISTIDINOL ==
 * common-name:
-** epoxypheophorbide a
+** histidinol
 * smiles:
-** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
+** c1(nc=nc=1cc(co)[n+])
 * inchi-key:
-** zmtpzdvbgynplz-ygowezgdsa-m
+** zqisrdcjnbuvmm-yfkpbyrvsa-o
 * molecular-weight:
-** 606.677
+** 142.18
 == Reaction(s) known to consume the compound ==
+* [[HISTOLDEHYD-RXN]]
+* [[RXN-8001]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17252]]
+* [[HISTIDPHOS-RXN]]
+* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
+* [[HISTOLDEHYD-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=epoxypheophorbide a}}
+{{#set: common-name=histidinol}}
-{{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}}
+{{#set: inchi-key=inchikey=zqisrdcjnbuvmm-yfkpbyrvsa-o}}
-{{#set: molecular-weight=606.677}}
+{{#set: molecular-weight=142.18}}