Difference between revisions of "Large-branched-glucans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18666 == * common-name: ** epoxypheophorbide a * smiles: ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c...")
(Created page with "Category:metabolite == Metabolite Large-branched-glucans == * common-name: ** a large-branched glucan == Reaction(s) known to consume the compound == == Reaction(s) known...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18666 ==
+
== Metabolite Large-branched-glucans ==
 
* common-name:
 
* common-name:
** epoxypheophorbide a
+
** a large-branched glucan
* smiles:
 
** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
 
* inchi-key:
 
** zmtpzdvbgynplz-ygowezgdsa-m
 
* molecular-weight:
 
** 606.677
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17252]]
+
* [[RXN-1823]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=epoxypheophorbide a}}
+
{{#set: common-name=a large-branched glucan}}
{{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}}
 
{{#set: molecular-weight=606.677}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Large-branched-glucans

  • common-name:
    • a large-branched glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality