Difference between revisions of "Large-branched-glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXY-D-RIBOSE-1-PHOSPHATE == * common-name: ** 2-deoxy-α-d-ribose 1-phosphate * smiles: ** c1(c(o)c(co)oc1op(=o)([o-])[o-]) * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-23713 == == Reaction(s) known to consume the compound == * RXN-21834 == Reaction(s) known to produce the compound == * RXN-2183...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-23713 == |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-21834]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-21833]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
