Difference between revisions of "Light"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4617 == * common-name: ** dihydrozeatin-o-glucoside * smiles: ** cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(c(c(c(o3)co)o)o)o) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Light == * common-name: ** hν == Reaction(s) known to consume the compound == * DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN * ExchangeS...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Light == |
* common-name: | * common-name: | ||
| − | ** | + | ** hν |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN]] | ||
| + | * [[ExchangeSeed-Light]] | ||
| + | * [[PSII-RXN]] | ||
| + | * [[RXN-5285]] | ||
| + | * [[RXN1F-10]] | ||
| + | * [[TransportSeed-Light]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-Light]] |
| + | * [[TransportSeed-Light]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hν}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Light
- common-name:
- hν
Reaction(s) known to consume the compound
- DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN
- ExchangeSeed-Light
- PSII-RXN
- RXN-5285
- RXN1F-10
- TransportSeed-Light
