Difference between revisions of "Lignoceroyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19153 == * common-name: ** 3-oxo-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...")
(Created page with "Category:metabolite == Metabolite Lignoceroyl-ACPs == * common-name: ** a lignoceroyl-[acp] == Reaction(s) known to consume the compound == * RXN-10059 == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19153 ==
+
== Metabolite Lignoceroyl-ACPs ==
 
* common-name:
 
* common-name:
** 3-oxo-(5z)-dodecenoyl-coa
+
** a lignoceroyl-[acp]
* smiles:
 
** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** vklhslowdwgvgp-cggpsvllsa-j
 
* molecular-weight:
 
** 957.775
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17799]]
+
* [[RXN-10059]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17798]]
+
* [[RXN1G-526]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(5z)-dodecenoyl-coa}}
+
{{#set: common-name=a lignoceroyl-[acp]}}
{{#set: inchi-key=inchikey=vklhslowdwgvgp-cggpsvllsa-j}}
 
{{#set: molecular-weight=957.775}}
 

Revision as of 14:57, 5 January 2021

Metabolite Lignoceroyl-ACPs

  • common-name:
    • a lignoceroyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a lignoceroyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.