Difference between revisions of "Linoleoyl-groups"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17541 == * common-name: ** dapdiamide c * smiles: ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** mjpkmdapfrgjgv-f...") |
(Created page with "Category:metabolite == Metabolite Linoleoyl-groups == * common-name: ** a [glycerolipid]-linoleate == Reaction(s) known to consume the compound == * 1.14.99.33-RXN * [...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Linoleoyl-groups == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycerolipid]-linoleate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.14.99.33-RXN]] | ||
| + | * [[RXN-11680]] | ||
| + | * [[RXN-16045]] | ||
| + | * [[RXN-16046]] | ||
| + | * [[RXN-9667]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9669]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-linoleate}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Linoleoyl-groups
- common-name:
- a [glycerolipid]-linoleate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-linoleate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
