Difference between revisions of "Lipid-dihydrosterculate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...") |
(Created page with "Category:metabolite == Metabolite 1-Linoleoyl-L-Phosphatidate == * common-name: ** a 1-linoleoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compoun...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-Linoleoyl-L-Phosphatidate == |
* common-name: | * common-name: | ||
| − | ** 2 | + | ** a 1-linoleoyl 2-acyl-sn-glycerol 3-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16071]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2 | + | {{#set: common-name=a 1-linoleoyl 2-acyl-sn-glycerol 3-phosphate}} |
| − | |||
| − | |||
Revision as of 08:24, 15 March 2021
Contents
Metabolite 1-Linoleoyl-L-Phosphatidate
- common-name:
- a 1-linoleoyl 2-acyl-sn-glycerol 3-phosphate
