Difference between revisions of "Lipid-dihydrosterculate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...")
(Created page with "Category:metabolite == Metabolite Lipid-dihydrosterculate == * common-name: ** a [glycerolipid]-dihydrosterculate == Reaction(s) known to consume the compound == == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEOXYCYTIDINE ==
+
== Metabolite Lipid-dihydrosterculate ==
 
* common-name:
 
* common-name:
** 2'-deoxycytidine
+
** a [glycerolipid]-dihydrosterculate
* smiles:
 
** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2))
 
* inchi-key:
 
** cktsbutuhbmzgz-shyzeuofsa-n
 
* molecular-weight:
 
** 227.219
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYTIDEAM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7421]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxycytidine}}
+
{{#set: common-name=a [glycerolipid]-dihydrosterculate}}
{{#set: inchi-key=inchikey=cktsbutuhbmzgz-shyzeuofsa-n}}
 
{{#set: molecular-weight=227.219}}
 

Revision as of 14:53, 5 January 2021

Metabolite Lipid-dihydrosterculate

  • common-name:
    • a [glycerolipid]-dihydrosterculate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-dihydrosterculate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.