Difference between revisions of "Lipid-dihydrosterculate"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06158 == * transcription-direction: ** positive * right-end-position: ** 40664 * left-end-position: ** 10582 * centisome-position: ** 12.752777...") |
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DEOXYCYTIDINE == |
| − | * | + | * common-name: |
| − | ** | + | ** 2'-deoxycytidine |
| − | * | + | * smiles: |
| − | ** | + | ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** cktsbutuhbmzgz-shyzeuofsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 227.219 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[CYTIDEAM-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=2'-deoxycytidine}} | |
| − | + | {{#set: inchi-key=inchikey=cktsbutuhbmzgz-shyzeuofsa-n}} | |
| − | + | {{#set: molecular-weight=227.219}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite DEOXYCYTIDINE
- common-name:
- 2'-deoxycytidine
- smiles:
- c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2))
- inchi-key:
- cktsbutuhbmzgz-shyzeuofsa-n
- molecular-weight:
- 227.219
