Difference between revisions of "Lipoyl-Protein-L-Lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-367 == * common-name: ** (2r)-3-sulfolactate * smiles: ** c(=o)([o-])c(o)cs([o-])(=o)=o * inchi-key: ** cqqgiwjsicouon-reohclbhsa-l *...") |
(Created page with "Category:metabolite == Metabolite Lipoyl-Protein-L-Lysine == * common-name: ** a [lipoyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * RXN-...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Lipoyl-Protein-L-Lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [lipoyl-carrier protein]-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17127]] |
| + | * [[RXN-8655]] | ||
| + | * [[RXN0-5098]] | ||
| + | * [[RXN0-947]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [lipoyl-carrier protein]-l-lysine}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Lipoyl-Protein-L-Lysine
- common-name:
- a [lipoyl-carrier protein]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [lipoyl-carrier protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
