Difference between revisions of "Lipoyl-Protein-N6-lipoyllysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SUCROSE == * common-name: ** sucrose * smiles: ** c(c2(oc(oc1(oc(co)c(c(o)1)o)co)c(c(o)c2o)o))o * inchi-key: ** czmrcdwagmrecn-ugdnzrgbsa...") |
(Created page with "Category:metabolite == Metabolite L-seryl-SEC-tRNAs == * common-name: ** an l-seryl-[trnasec] == Reaction(s) known to consume the compound == * RXN-10038 == Reaction(s...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-seryl-SEC-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** an l-seryl-[trnasec] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10038]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10038]] |
+ | * [[RXN0-2161]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an l-seryl-[trnasec]}} |
− | |||
− |
Revision as of 15:28, 5 January 2021
Contents
Metabolite L-seryl-SEC-tRNAs
- common-name:
- an l-seryl-[trnasec]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-seryl-[trnasec" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.