Difference between revisions of "Long-Chain-Acyl-CoAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11444 == * common-name: ** uroporphyrinogen-i * smiles: ** c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(c...")
(Created page with "Category:metabolite == Metabolite 16S-rRNA-uracil1498 == * common-name: ** a uracil1498 in 16s rrna == Reaction(s) known to consume the compound == * RXN-11598 == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11444 ==
+
== Metabolite 16S-rRNA-uracil1498 ==
 
* common-name:
 
* common-name:
** uroporphyrinogen-i
+
** a uracil1498 in 16s rrna
* smiles:
 
** c(=o)([o-])ccc5(=c4(nc(cc1(nc(=c(cc([o-])=o)c(ccc(=o)[o-])=1)cc2(nc(=c(c(ccc(=o)[o-])=2)cc(=o)[o-])cc3(=c(ccc([o-])=o)c(cc(=o)[o-])=c(n3)c4))))=c(cc(=o)[o-])5))
 
* inchi-key:
 
** qttnoskslatgqb-uhfffaoysa-f
 
* molecular-weight:
 
** 828.742
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10642]]
+
* [[RXN-11598]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uroporphyrinogen-i}}
+
{{#set: common-name=a uracil1498 in 16s rrna}}
{{#set: inchi-key=inchikey=qttnoskslatgqb-uhfffaoysa-f}}
 
{{#set: molecular-weight=828.742}}
 

Revision as of 08:30, 15 March 2021

Metabolite 16S-rRNA-uracil1498

  • common-name:
    • a uracil1498 in 16s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality