Difference between revisions of "Long-Chain-Acyl-CoAs"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 3-HYDROXY-3-METHYL-GLUTARYL-COA ==
+== Metabolite Long-Chain-Acyl-CoAs ==
 * common-name:
-** (s)-3-hydroxy-3-methylglutaryl-coa
+** a long-chain acyl-coa
-* smiles:
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(c)(o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
-* inchi-key:
-** cabvtrnmfuvudm-vrhqgpglsa-i
-* molecular-weight:
-** 906.621
 == Reaction(s) known to consume the compound ==
-* [[1.1.1.34-RXN]]
+* [[2.3.1.42-RXN]]
-* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
+* [[2.3.1.75-RXN]]
-* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
+* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
+* [[RXN-12639]]
+* [[RXN-16066]]
+* [[RXN-16395]]
+* [[RXN-9918]]
+* [[RXNQT-4193]]
 == Reaction(s) known to produce the compound ==
-* [[1.1.1.34-RXN]]
+* [[RXN-16066]]
-* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
+* [[RXN-7904]]
+* [[RXN-9918]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-3-hydroxy-3-methylglutaryl-coa}}
+{{#set: common-name=a long-chain acyl-coa}}
-{{#set: inchi-key=inchikey=cabvtrnmfuvudm-vrhqgpglsa-i}}
-{{#set: molecular-weight=906.621}}