Difference between revisions of "Long-Chain-Acyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...") |
(Created page with "Category:metabolite == Metabolite Long-Chain-Acyl-CoAs == * common-name: ** a long-chain acyl-coa == Reaction(s) known to consume the compound == * 2.3.1.42-RXN * 2....") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Long-Chain-Acyl-CoAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a long-chain acyl-coa |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.3.1.42-RXN]] |
+ | * [[2.3.1.75-RXN]] | ||
+ | * [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]] | ||
+ | * [[RXN-12639]] | ||
+ | * [[RXN-16066]] | ||
+ | * [[RXN-16395]] | ||
+ | * [[RXN-9918]] | ||
+ | * [[RXNQT-4193]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16066]] |
− | * [[RXN- | + | * [[RXN-7904]] |
− | * [[RXN- | + | * [[RXN-9918]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a long-chain acyl-coa}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Long-Chain-Acyl-CoAs
- common-name:
- a long-chain acyl-coa
Reaction(s) known to consume the compound
- 2.3.1.42-RXN
- 2.3.1.75-RXN
- LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN
- RXN-12639
- RXN-16066
- RXN-16395
- RXN-9918
- RXNQT-4193