Difference between revisions of "Long-Chain-Acyl-CoAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18202 RXN-18202] == * direction: ** reversible == Reaction formula == * 1 CPDQT-39[c] '''+'...")
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18202 RXN-18202] ==
+
== Metabolite CPD-13122 ==
−
* direction:
+
* common-name:
−
** reversible
+
** 4-deoxy-l-threo-hex-4-enopyranuronate
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CPDQT-39]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[CPD-19488]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
** c(c1(oc(c(c(c=1)o)o)o))([o-])=o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ21291]]
+
** iakkjsvsfctlry-baktxgbysa-m
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 175.118
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
* [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450]
+
* [[RXN-16512]]
−
** '''5''' reactions found over '''30''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-12177]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-12178]]
−
== External links  ==
+
* [[RXN-12270]]
−
{{#set: direction=reversible}}
+
* [[RXN-16485]]
−
{{#set: nb gene associated=1}}
+
* [[RXN-16512]]
−
{{#set: nb pathway associated=1}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction category=annotation}}
+
{{#set: common-name=4-deoxy-l-threo-hex-4-enopyranuronate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi-key=inchikey=iakkjsvsfctlry-baktxgbysa-m}}
−
{{#set: reconstruction comment=n.a}}
+
{{#set: molecular-weight=175.118}}
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-13122

  • common-name:
    • 4-deoxy-l-threo-hex-4-enopyranuronate
  • smiles:
    • c(c1(oc(c(c(c=1)o)o)o))([o-])=o
  • inchi-key:
    • iakkjsvsfctlry-baktxgbysa-m
  • molecular-weight:
    • 175.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Long-Chain-Acyl-CoAs&oldid=48085"