Difference between revisions of "Long-Chain-Acyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...") |
(Created page with "Category:metabolite == Metabolite Membrane-Compartments == * common-name: ** a membrane compartment == Reaction(s) known to consume the compound == * 3.6.4.6-RXN == Re...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Membrane-Compartments == |
* common-name: | * common-name: | ||
| − | ** | + | ** a membrane compartment |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.6.4.6-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.6.4.6-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a membrane compartment}} |
| − | |||
| − | |||
Revision as of 13:12, 14 January 2021
Contents
Metabolite Membrane-Compartments
- common-name:
- a membrane compartment
