Difference between revisions of "Long-Chain-Acyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18202 RXN-18202] == * direction: ** reversible == Reaction formula == * 1 CPDQT-39[c] '''+'...") |
(Created page with "Category:metabolite == Metabolite CPD-13122 == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o * inchi-key: ** iakkjsv...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13122 == |
− | * | + | * common-name: |
− | ** | + | ** 4-deoxy-l-threo-hex-4-enopyranuronate |
− | + | * smiles: | |
− | * | + | ** c(c1(oc(c(c(c=1)o)o)o))([o-])=o |
− | + | * inchi-key: | |
− | * | + | ** iakkjsvsfctlry-baktxgbysa-m |
− | ** | + | * molecular-weight: |
− | *** | + | ** 175.118 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-16512]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12177]] | |
− | + | * [[RXN-12178]] | |
− | == | + | * [[RXN-12270]] |
− | {{#set: | + | * [[RXN-16485]] |
− | {{#set: | + | * [[RXN-16512]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=4-deoxy-l-threo-hex-4-enopyranuronate}} |
− | + | {{#set: inchi-key=inchikey=iakkjsvsfctlry-baktxgbysa-m}} | |
− | + | {{#set: molecular-weight=175.118}} | |
− |
Revision as of 20:36, 18 December 2020
Contents
Metabolite CPD-13122
- common-name:
- 4-deoxy-l-threo-hex-4-enopyranuronate
- smiles:
- c(c1(oc(c(c(c=1)o)o)o))([o-])=o
- inchi-key:
- iakkjsvsfctlry-baktxgbysa-m
- molecular-weight:
- 175.118