Difference between revisions of "Long-Chain-Acyl-Ethyl-Esters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9098 == * common-name: ** geranylgeranyl bacteriopheophytin * smiles: ** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c...")
(Created page with "Category:metabolite == Metabolite 3beta-hydroxy-4alpha-carboxy-sterols == * common-name: ** a 3β-hydroxy-4α-carboxysteroid == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9098 ==
+
== Metabolite 3beta-hydroxy-4alpha-carboxy-sterols ==
 
* common-name:
 
* common-name:
** geranylgeranyl bacteriopheophytin
+
** a 3β-hydroxy-4α-carboxysteroid
* smiles:
 
** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
 
* inchi-key:
 
** ijmymfmuuouget-riziqltbsa-n
 
* molecular-weight:
 
** 882.173
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17427]]
+
* [[RXN-13926]]
* [[RXN-8794]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13926]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=a 3β-hydroxy-4α-carboxysteroid}}
{{#set: inchi-key=inchikey=ijmymfmuuouget-riziqltbsa-n}}
 
{{#set: molecular-weight=882.173}}
 

Revision as of 13:09, 14 January 2021

Metabolite 3beta-hydroxy-4alpha-carboxy-sterols

  • common-name:
    • a 3β-hydroxy-4α-carboxysteroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality