Difference between revisions of "Long-Chain-Aldehydes"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D7-tetradecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** 4-coumaroyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-oxo-cis-D7-tetradecenoyl-ACPs ==
+
== Metabolite P-COUMAROYL-COA ==
 
* common-name:
 
* common-name:
** a 3-oxo-cis-δ7-tetradecenoyl-[acp]
+
** 4-coumaroyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** dmzokbalnzwdki-matmfaihsa-j
 +
* molecular-weight:
 +
** 909.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10655]]
+
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
 +
* [[RXN-1101]]
 +
* [[RXN-11244]]
 +
* [[RXN-3142]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10654]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-cis-δ7-tetradecenoyl-[acp]}}
+
{{#set: common-name=4-coumaroyl-coa}}
 +
{{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}}
 +
{{#set: molecular-weight=909.648}}

Revision as of 11:12, 15 January 2021

Metabolite P-COUMAROYL-COA

  • common-name:
    • 4-coumaroyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • dmzokbalnzwdki-matmfaihsa-j
  • molecular-weight:
    • 909.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality