Difference between revisions of "Long-Chain-Aldehydes"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15676 == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite Long-Chain-Aldehydes == * common-name: ** a long-chain aldehyde == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15676 ==
+
== Metabolite Long-Chain-Aldehydes ==
 
* common-name:
 
* common-name:
** 6-trans-3-oxo-tridecenoyl-coa
+
** a long-chain aldehyde
* smiles:
 
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** fdxhxlpclxeysu-hmxwsvnbsa-j
 
* molecular-weight:
 
** 971.802
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14788]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 +
* [[RXN-4444]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-trans-3-oxo-tridecenoyl-coa}}
+
{{#set: common-name=a long-chain aldehyde}}
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-hmxwsvnbsa-j}}
 
{{#set: molecular-weight=971.802}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Long-Chain-Aldehydes

  • common-name:
    • a long-chain aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality