Difference between revisions of "Long-Chain-Fatty-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRYPTAMINE == * common-name: ** tryptamine * smiles: ** c([n+])cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** apjydqyyacxcrm-uhfffaoysa-o * molec...") |
(Created page with "Category:metabolite == Metabolite Gamma-linolenoyl-groups == * common-name: ** a [glycerolipid]-γ-linolenate == Reaction(s) known to consume the compound == * RXN-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Gamma-linolenoyl-groups == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycerolipid]-γ-linolenate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11681]] |
| − | * [[ | + | * [[RXN-16040]] |
| + | * [[RXN-16043]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11680]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-γ-linolenate}} |
| − | |||
| − | |||
Revision as of 11:16, 15 January 2021
Contents
Metabolite Gamma-linolenoyl-groups
- common-name:
- a [glycerolipid]-γ-linolenate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-γ-linolenate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
