Difference between revisions of "Long-Chain-Fatty-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TRYPTAMINE == * common-name: ** tryptamine * smiles: ** c([n+])cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** apjydqyyacxcrm-uhfffaoysa-o * molec...")
(Created page with "Category:metabolite == Metabolite Long-Chain-Fatty-Acids == * common-name: ** a long-chain fatty acid == Reaction(s) known to consume the compound == * RXN-7904 == Rea...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TRYPTAMINE ==
+
== Metabolite Long-Chain-Fatty-Acids ==
 
* common-name:
 
* common-name:
** tryptamine
+
** a long-chain fatty acid
* smiles:
 
** c([n+])cc1(=cnc2(c=cc=cc1=2))
 
* inchi-key:
 
** apjydqyyacxcrm-uhfffaoysa-o
 
* molecular-weight:
 
** 161.226
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1401]]
+
* [[RXN-7904]]
* [[STRICTOSIDINE-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
+
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
 +
* [[FATTY-ACID-SYNTHASE-RXN]]
 +
* [[RXN-16395]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tryptamine}}
+
{{#set: common-name=a long-chain fatty acid}}
{{#set: inchi-key=inchikey=apjydqyyacxcrm-uhfffaoysa-o}}
 
{{#set: molecular-weight=161.226}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Long-Chain-Fatty-Acids

  • common-name:
    • a long-chain fatty acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality