Difference between revisions of "Long-Chain-Fatty-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRYPTAMINE == * common-name: ** tryptamine * smiles: ** c([n+])cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** apjydqyyacxcrm-uhfffaoysa-o * molec...") |
(Created page with "Category:metabolite == Metabolite Long-Chain-Fatty-Acids == * common-name: ** a long-chain fatty acid == Reaction(s) known to consume the compound == * RXN-7904 == Rea...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Long-Chain-Fatty-Acids == |
* common-name: | * common-name: | ||
− | ** | + | ** a long-chain fatty acid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7904]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]] |
+ | * [[FATTY-ACID-SYNTHASE-RXN]] | ||
+ | * [[RXN-16395]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a long-chain fatty acid}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Long-Chain-Fatty-Acids
- common-name:
- a long-chain fatty acid