Difference between revisions of "Long-Chain-Fatty-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID == * common-name: ** a 1-organyl-2-lyso-sn-glycero-3-phospholipid == Reaction(s) known to consum...")
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-RADYL-2-ACYL-SN-GLYCERO-3-PHOSPHOLIPID ==
+
== Metabolite CPD-12904 ==
 
* common-name:
 
* common-name:
** a 1-organyl-2-lyso-sn-glycero-3-phospholipid
+
** (2e)-5-methylhexa-2,4-dienoyl-coa
 +
* smiles:
 +
** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** ifmyvrqehqtins-meoyllpmsa-j
 +
* molecular-weight:
 +
** 871.642
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.149-RXN]]
+
* [[RXN-11919]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.149-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1-organyl-2-lyso-sn-glycero-3-phospholipid}}
+
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
 +
{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
 +
{{#set: molecular-weight=871.642}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-12904

  • common-name:
    • (2e)-5-methylhexa-2,4-dienoyl-coa
  • smiles:
    • cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ifmyvrqehqtins-meoyllpmsa-j
  • molecular-weight:
    • 871.642

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality