Difference between revisions of "Long-Chain-Polyphosphate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6746 == * common-name: ** 1d-myo-inositol 2-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])([o-])=o)c(o)c(o)1) * inchi-key: ** in...") |
(Created page with "Category:metabolite == Metabolite Long-Chain-Polyphosphate == * common-name: ** long chain polyphosphate == Reaction(s) known to consume the compound == * EXOPOLYPHOSPHA...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Long-Chain-Polyphosphate == |
* common-name: | * common-name: | ||
− | ** | + | ** long chain polyphosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[EXOPOLYPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[EXOPOLYPHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=long chain polyphosphate}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Long-Chain-Polyphosphate
- common-name:
- long chain polyphosphate