Difference between revisions of "Long-Chain-oxoacyl-CoAs"

Latest revision as of 11:12, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17264 ==
+== Metabolite Long-Chain-oxoacyl-CoAs ==
 * common-name:
-** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
+** a long-chain 3-oxoacyl-coa
-* smiles:
-** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
-* inchi-key:
-** ptromslvpfeiqj-qpyoymcksa-j
-* molecular-weight:
-** 1047.943
 == Reaction(s) known to consume the compound ==
+* [[1.1.1.211-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16021]]
+* [[1.1.1.211-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa}}
+{{#set: common-name=a long-chain 3-oxoacyl-coa}}
-{{#set: inchi-key=inchikey=ptromslvpfeiqj-qpyoymcksa-j}}
-{{#set: molecular-weight=1047.943}}