Difference between revisions of "Long-chain-alcohols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-PRENYLPHLORISOBUTYROPHENONE == * common-name: ** 4-prenylphlorisobutyrophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c...")
(Created page with "Category:metabolite == Metabolite Long-chain-alcohols == * common-name: ** a long-chain alcohol == Reaction(s) known to consume the compound == * 2.3.1.75-RXN * ALKY...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-PRENYLPHLORISOBUTYROPHENONE ==
+
== Metabolite Long-chain-alcohols ==
 
* common-name:
 
* common-name:
** 4-prenylphlorisobutyrophenone
+
** a long-chain alcohol
* smiles:
 
** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c
 
* inchi-key:
 
** iobxamcsycvnet-uhfffaoysa-m
 
* molecular-weight:
 
** 263.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7813]]
+
* [[2.3.1.75-RXN]]
 +
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
 +
* [[RXN-4444]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-prenylphlorisobutyrophenone}}
+
{{#set: common-name=a long-chain alcohol}}
{{#set: inchi-key=inchikey=iobxamcsycvnet-uhfffaoysa-m}}
 
{{#set: molecular-weight=263.313}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Long-chain-alcohols

  • common-name:
    • a long-chain alcohol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality