Difference between revisions of "Long-chain-alcohols"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18404 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite 4-PRENYLPHLORISOBUTYROPHENONE == * common-name: ** 4-prenylphlorisobutyrophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 4-PRENYLPHLORISOBUTYROPHENONE == |
| − | + | * common-name: | |
| − | * | + | ** 4-prenylphlorisobutyrophenone |
| − | + | * smiles: | |
| − | + | ** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c | |
| − | + | * inchi-key: | |
| − | ** | + | ** iobxamcsycvnet-uhfffaoysa-m |
| − | + | * molecular-weight: | |
| − | * | + | ** 263.313 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-7813]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=4-prenylphlorisobutyrophenone}} |
| − | + | {{#set: inchi-key=inchikey=iobxamcsycvnet-uhfffaoysa-m}} | |
| − | ** | + | {{#set: molecular-weight=263.313}} |
| − | == | ||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:30, 18 December 2020
Contents
Metabolite 4-PRENYLPHLORISOBUTYROPHENONE
- common-name:
- 4-prenylphlorisobutyrophenone
- smiles:
- cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c
- inchi-key:
- iobxamcsycvnet-uhfffaoysa-m
- molecular-weight:
- 263.313
