Difference between revisions of "Long-chain-alcohols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-PRENYLPHLORISOBUTYROPHENONE == * common-name: ** 4-prenylphlorisobutyrophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c...")
(Created page with "Category:metabolite == Metabolite CPD-3 == * common-name: ** molybdate * smiles: ** [mo](=o)(=o)([o-])[o-] * inchi-key: ** mefbjemvzonfcj-uhfffaoysa-n * molecular-weight:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-PRENYLPHLORISOBUTYROPHENONE ==
+
== Metabolite CPD-3 ==
 
* common-name:
 
* common-name:
** 4-prenylphlorisobutyrophenone
+
** molybdate
 
* smiles:
 
* smiles:
** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c
+
** [mo](=o)(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** iobxamcsycvnet-uhfffaoysa-m
+
** mefbjemvzonfcj-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 263.313
+
** 159.938
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7813]]
+
* [[ExchangeSeed-CPD-3]]
 +
* [[RXN-8348]]
 +
* [[TransportSeed-CPD-3]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ExchangeSeed-CPD-3]]
 +
* [[TransportSeed-CPD-3]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-prenylphlorisobutyrophenone}}
+
{{#set: common-name=molybdate}}
{{#set: inchi-key=inchikey=iobxamcsycvnet-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=mefbjemvzonfcj-uhfffaoysa-n}}
{{#set: molecular-weight=263.313}}
+
{{#set: molecular-weight=159.938}}

Revision as of 14:53, 5 January 2021

Metabolite CPD-3

  • common-name:
    • molybdate
  • smiles:
    • [mo](=o)(=o)([o-])[o-]
  • inchi-key:
    • mefbjemvzonfcj-uhfffaoysa-n
  • molecular-weight:
    • 159.938

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality