Difference between revisions of "Long-linear-glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...") |
(Created page with "Category:metabolite == Metabolite Long-linear-glucans == * common-name: ** a long-linear α-d-glucan == Reaction(s) known to consume the compound == * RXN-1825 *...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Long-linear-glucans == |
* common-name: | * common-name: | ||
| − | ** | + | ** a long-linear α-d-glucan |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-1825]] | |
| − | + | * [[RXN-1826]] | |
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-1826]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a long-linear α-d-glucan}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Long-linear-glucans
- common-name:
- a long-linear α-d-glucan
