Difference between revisions of "Long-linear-glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19148 == * common-name: ** (5z)-dodecenoyl-coa * smiles: ** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...") |
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite IDP == |
* common-name: | * common-name: | ||
| − | ** | + | ** idp |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jpxzqmkkfwmmgk-kqynxxcusa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 425.165 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ADP-DEAMINASE-RXN]] |
| + | * [[ATID]] | ||
| + | * [[ATIDm]] | ||
| + | * [[RXN-14003]] | ||
| + | * [[RXN-14120]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ADP-DEAMINASE-RXN]] |
| + | * [[ITCY]] | ||
| + | * [[ITUP]] | ||
| + | * [[RXN-14120]] | ||
| + | * [[RXN0-5073]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=idp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jpxzqmkkfwmmgk-kqynxxcusa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=425.165}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite IDP
- common-name:
- idp
- smiles:
- c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- jpxzqmkkfwmmgk-kqynxxcusa-k
- molecular-weight:
- 425.165
