Difference between revisions of "Long-linear-glucans"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...") |
(Created page with "Category:metabolite == Metabolite CPD-148 == * common-name: ** n-octane * smiles: ** cccccccc * inchi-key: ** tvmxdcgiabbofy-uhfffaoysa-n * molecular-weight: ** 114.23 ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-148 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-octane |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccc |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** tvmxdcgiabbofy-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 114.23 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ALKANE-1-MONOOXYGENASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-octane}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=tvmxdcgiabbofy-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=114.23}} |
Revision as of 15:28, 5 January 2021
Contents
Metabolite CPD-148
- common-name:
- n-octane
- smiles:
- cccccccc
- inchi-key:
- tvmxdcgiabbofy-uhfffaoysa-n
- molecular-weight:
- 114.23
