Difference between revisions of "LysW-L-glutamate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...") |
(Created page with "Category:metabolite == Metabolite LysW-L-glutamate == * common-name: ** a [2-aminoadipate carrier protein]-l-glutamate == Reaction(s) known to consume the compound == * ...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite L- | + | == Metabolite LysW-L-glutamate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [2-aminoadipate carrier protein]-l-glutamate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15005]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [2-aminoadipate carrier protein]-l-glutamate}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite LysW-L-glutamate
- common-name:
- a [2-aminoadipate carrier protein]-l-glutamate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [2-aminoadipate carrier protein]-l-glutamate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
