Difference between revisions of "LysW-L-glutamate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-GLYCERO-PHOSPHORYLCHOLINE == * common-name: ** sn-glycero-3-phosphocholine * smiles: ** c([n+](c)(c)c)cop([o-])(=o)occ(o)co * inchi-k...") |
(Created page with "Category:metabolite == Metabolite CD-SP-2Fe2S-Complex == * common-name: ** a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex == Reaction(s) known to consume the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CD-SP-2Fe2S-Complex == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14387]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex}} |
| − | |||
| − | |||
Revision as of 14:58, 5 January 2021
Contents
Metabolite CD-SP-2Fe2S-Complex
- common-name:
- a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [cysteine desulfurase]-[scaffold protein-(2fe-2s)] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
