Difference between revisions of "LysW-L-ornithine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THYMIDINE == * common-name: ** thymidine * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) * inchi-key: ** iqfyykkmvgjfeh-xlpzgreqsa-n...") |
(Created page with "Category:metabolite == Metabolite LysW-L-ornithine == * common-name: ** a [2-aminoadipate carrier protein]-l-ornithine == Reaction(s) known to consume the compound == * ...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LysW-L-ornithine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [2-aminoadipate carrier protein]-l-ornithine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15007]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15007]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [2-aminoadipate carrier protein]-l-ornithine}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite LysW-L-ornithine
- common-name:
- a [2-aminoadipate carrier protein]-l-ornithine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [2-aminoadipate carrier protein]-l-ornithine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
