Difference between revisions of "M7G5-pppRm-mRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13401 == * common-name: ** l-alanyl-l-histidine * smiles: ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** xzwxfwbhyrflef-fs...") |
(Created page with "Category:metabolite == Metabolite m7G5-pppRm-mRNAs == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyl-purine-ribonucleotide)-[mrna] == Reaction(s) k...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite m7G5-pppRm-mRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyl-purine-ribonucleotide)-[mrna] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.1.1.57-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyl-purine-ribonucleotide)-[mrna]}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite m7G5-pppRm-mRNAs
- common-name:
- a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyl-purine-ribonucleotide)-[mrna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyl-purine-ribonucleotide)-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
