Difference between revisions of "M7G5-pppRm-mRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BTUR2-RXN BTUR2-RXN] == * direction: ** left-to-right * common-name: ** cobinamide adenosyltransfer...")
(Created page with "Category:metabolite == Metabolite CPD-13401 == * common-name: ** l-alanyl-l-histidine * smiles: ** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** xzwxfwbhyrflef-fs...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BTUR2-RXN BTUR2-RXN] ==
+
== Metabolite CPD-13401 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** cobinamide adenosyltransferase
+
** l-alanyl-l-histidine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.5.1.17 ec-2.5.1.17]
+
** cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[COBINAMIDE]][c] '''=>''' 1 [[ADENOSYLCOBINAMIDE]][c] '''+''' 1 [[P3I]][c]
+
** xzwxfwbhyrflef-fsplstopsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11469]]
+
** 226.235
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-6978]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=l-alanyl-l-histidine}}
−
* [[COBALSYN-PWY]], superpathway of adenosylcobalamin salvage from cobinamide I: [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY]
+
{{#set: inchi-key=inchikey=xzwxfwbhyrflef-fsplstopsa-n}}
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
{{#set: molecular-weight=226.235}}
−
* [[PWY-6269]], superpathway of adenosylcobalamin salvage from cobinamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14726 14726]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07268 R07268]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=cobinamide adenosyltransferase}}
 
−
{{#set: ec-number=ec-2.5.1.17}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD-13401

  • common-name:
    • l-alanyl-l-histidine
  • smiles:
    • cc([n+])c(=o)nc(cc1(=cnc=n1))c(=o)[o-]
  • inchi-key:
    • xzwxfwbhyrflef-fsplstopsa-n
  • molecular-weight:
    • 226.235

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=M7G5-pppRm-mRNAs&oldid=48561"