Difference between revisions of "M7G5-pppm6Am-mRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == * common-name: ** 1-o-sinapoyl-β-d-glucose * smiles: ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc...")
(Created page with "Category:metabolite == Metabolite OXIDIZED-DITHIOTHREITOL == * common-name: ** oxidized dithiothreitol * smiles: ** c1(sscc(o)c(o)1) * inchi-key: ** ypgmowhxeqdbbv-imjsidk...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE ==
+
== Metabolite OXIDIZED-DITHIOTHREITOL ==
 
* common-name:
 
* common-name:
** 1-o-sinapoyl-β-d-glucose
+
** oxidized dithiothreitol
 
* smiles:
 
* smiles:
** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc)
+
** c1(sscc(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** xrkbrpftfkkhef-dgdbgzaxsa-n
+
** ypgmowhxeqdbbv-imjsidkusa-n
 
* molecular-weight:
 
* molecular-weight:
** 386.355
+
** 152.226
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.91-RXN]]
+
* [[1.1.4.1-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.4.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-o-sinapoyl-β-d-glucose}}
+
{{#set: common-name=oxidized dithiothreitol}}
{{#set: inchi-key=inchikey=xrkbrpftfkkhef-dgdbgzaxsa-n}}
+
{{#set: inchi-key=inchikey=ypgmowhxeqdbbv-imjsidkusa-n}}
{{#set: molecular-weight=386.355}}
+
{{#set: molecular-weight=152.226}}

Revision as of 11:17, 15 January 2021

Metabolite OXIDIZED-DITHIOTHREITOL

  • common-name:
    • oxidized dithiothreitol
  • smiles:
    • c1(sscc(o)c(o)1)
  • inchi-key:
    • ypgmowhxeqdbbv-imjsidkusa-n
  • molecular-weight:
    • 152.226

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality