Difference between revisions of "M7G5-pppm6Am-mRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-MethylAdenine-58 == * common-name: ** an n1-methyladenine58 in trna == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite GLC-6-P == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o * inchi-key: ** nbschqhzls...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLC-6-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-glucose 6-phosphate |
| + | * smiles: | ||
| + | ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o | ||
| + | * inchi-key: | ||
| + | ** nbschqhzlsjfnq-vfuothlcsa-l | ||
| + | * molecular-weight: | ||
| + | ** 258.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[G6PBDH]] | ||
| + | * [[G6PBDHh]] | ||
| + | * [[G6PI]] | ||
| + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | ||
| + | * [[PGIB]] | ||
| + | * [[PGIBh]] | ||
| + | * [[RXN66-579]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[G6PI]] |
| + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] | ||
| + | * [[PGIB]] | ||
| + | * [[PGIBh]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-glucose 6-phosphate}} |
| + | {{#set: inchi-key=inchikey=nbschqhzlsjfnq-vfuothlcsa-l}} | ||
| + | {{#set: molecular-weight=258.121}} | ||
Revision as of 14:58, 5 January 2021
Contents
Metabolite GLC-6-P
- common-name:
- β-d-glucose 6-phosphate
- smiles:
- c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o
- inchi-key:
- nbschqhzlsjfnq-vfuothlcsa-l
- molecular-weight:
- 258.121
