Difference between revisions of "M7G5-pppm6Am-mRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACYL-COA == * common-name: ** an acyl-coa == Reaction(s) known to consume the compound == * 2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN * ...") |
(Created page with "Category:metabolite == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == * common-name: ** 1-o-sinapoyl-β-d-glucose * smiles: ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-o-sinapoyl-β-d-glucose |
| + | * smiles: | ||
| + | ** coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc) | ||
| + | * inchi-key: | ||
| + | ** xrkbrpftfkkhef-dgdbgzaxsa-n | ||
| + | * molecular-weight: | ||
| + | ** 386.355 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[2.3.1.91-RXN]] | |
| − | * [[2.3.1. | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-o-sinapoyl-β-d-glucose}} |
| + | {{#set: inchi-key=inchikey=xrkbrpftfkkhef-dgdbgzaxsa-n}} | ||
| + | {{#set: molecular-weight=386.355}} | ||
Revision as of 18:57, 14 January 2021
Contents
Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE
- common-name:
- 1-o-sinapoyl-β-d-glucose
- smiles:
- coc2(=cc(c=cc(=o)oc1(c(o)c(c(c(o1)co)o)o))=cc(=c(o)2)oc)
- inchi-key:
- xrkbrpftfkkhef-dgdbgzaxsa-n
- molecular-weight:
- 386.355
