Difference between revisions of "MALONYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHO-ENOL-PYRUVATE == * common-name: ** phosphoenolpyruvate * smiles: ** c=c(op([o-])([o-])=o)c([o-])=o * inchi-key: ** dtbnbxwjwcwcik...") |
(Created page with "Category:metabolite == Metabolite MALONYL-ACP == * common-name: ** a malonyl-[acp] == Reaction(s) known to consume the compound == <div class="toccolours mw-collapsible mw...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MALONYL-ACP == |
* common-name: | * common-name: | ||
| − | ** | + | ** a malonyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2. | + | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;"> |
| − | * [[ | + | * [[2.3.1.179-RXN]] |
| − | * [[ | + | * [[2.3.1.180-RXN]] |
| − | * [[ | + | * [[2.3.1.41-RXN]] |
| − | * [[ | + | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]] |
| − | * [[ | + | * [[3-OXOACYL-ACP-SYNTH-RXN]] |
| − | * [[ | + | * [[RXN-10654]] |
| − | * [[ | + | * [[RXN-10658]] |
| − | * [[ | + | * [[RXN-11474]] |
| − | * [[RXN- | + | * [[RXN-11475]] |
| − | * [[RXN- | + | * [[RXN-11479]] |
| − | * [[RXN- | + | * [[RXN-16615]] |
| + | * [[RXN-16621]] | ||
| + | * [[RXN-16625]] | ||
| + | * [[RXN-16629]] | ||
| + | * [[RXN-8391]] | ||
| + | * [[RXN-9516]] | ||
| + | * [[RXN-9523]] | ||
| + | * [[RXN-9527]] | ||
| + | * [[RXN-9531]] | ||
| + | * [[RXN-9535]] | ||
| + | * [[RXN-9539]] | ||
| + | * [[RXN0-2141]] | ||
| + | * [[RXN1G-460]] | ||
| + | * [[RXN3O-1803]] | ||
| + | </div> | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[2. | + | * [[2.3.1.41-RXN]] |
| − | * [[ | + | * [[MALONYL-COA-ACP-TRANSACYL-RXN]] |
| − | + | * [[RXN1G-460]] | |
| − | |||
| − | * [[ | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a malonyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite MALONYL-ACP
- common-name:
- a malonyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a malonyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
