Difference between revisions of "MALONYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Fructose-BisPO4-Aldolase-Tri-Me-Lysine == * common-name: ** a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine == Reaction(s...")
(Created page with "Category:metabolite == Metabolite PHOSPHO-ENOL-PYRUVATE == * common-name: ** phosphoenolpyruvate * smiles: ** c=c(op([o-])([o-])=o)c([o-])=o * inchi-key: ** dtbnbxwjwcwcik...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Fructose-BisPO4-Aldolase-Tri-Me-Lysine ==
+
== Metabolite PHOSPHO-ENOL-PYRUVATE ==
 
* common-name:
 
* common-name:
** a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine
+
** phosphoenolpyruvate
 +
* smiles:
 +
** c=c(op([o-])([o-])=o)c([o-])=o
 +
* inchi-key:
 +
** dtbnbxwjwcwcik-uhfffaoysa-k
 +
* molecular-weight:
 +
** 165.019
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.5.1.19-RXN]]
 +
* [[2PGADEHYDRAT-RXN]]
 +
* [[DAHPSYN-RXN]]
 +
* [[GTPOP]]
 +
* [[PEPCARBOX-RXN]]
 +
* [[PEPDEPHOS-RXN]]
 +
* [[PEPPIth]]
 +
* [[PPC]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
* [[RXN-14117]]
 +
* [[RXN-14192]]
 +
* [[RXN-14207]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13588]]
+
* [[2.5.1.19-RXN]]
 +
* [[2PGADEHYDRAT-RXN]]
 +
* [[DAHPSYN-RXN]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PEPPIth]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=phosphoenolpyruvate}}
 +
{{#set: inchi-key=inchikey=dtbnbxwjwcwcik-uhfffaoysa-k}}
 +
{{#set: molecular-weight=165.019}}

Revision as of 14:54, 5 January 2021

Metabolite PHOSPHO-ENOL-PYRUVATE

  • common-name:
    • phosphoenolpyruvate
  • smiles:
    • c=c(op([o-])([o-])=o)c([o-])=o
  • inchi-key:
    • dtbnbxwjwcwcik-uhfffaoysa-k
  • molecular-weight:
    • 165.019

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality