Difference between revisions of "MALONYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHINE == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi-key: ** lrfvtywoqmyalw-uhfffaoysa-n * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite CPD-8621 == * common-name: ** zymostenol * smiles: ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(o)cc3)))cc4)))c * inchi-key:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8621 == |
* common-name: | * common-name: | ||
| − | ** | + | ** zymostenol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(o)cc3)))cc4)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qetlkndkqoxzrp-xtgbijofsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 386.66 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-24]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=zymostenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qetlkndkqoxzrp-xtgbijofsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=386.66}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-8621
- common-name:
- zymostenol
- smiles:
- cc(c)cccc([ch]4(c1(c)([ch](c2(=c(cc1)c3(c)([ch](cc2)cc(o)cc3)))cc4)))c
- inchi-key:
- qetlkndkqoxzrp-xtgbijofsa-n
- molecular-weight:
- 386.66
