Difference between revisions of "MALONYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...")
(Created page with "Category:metabolite == Metabolite ENT-KAUR-16-EN-19-AL == * common-name: ** ent-kaurenal * smiles: ** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c=o)cccc(c)2[ch]3cc4)))) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7247 ==
+
== Metabolite ENT-KAUR-16-EN-19-AL ==
 
* common-name:
 
* common-name:
** all-trans-13,14-dihydroretinol
+
** ent-kaurenal
 
* smiles:
 
* smiles:
** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1)
+
** c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c=o)cccc(c)2[ch]3cc4))))
 
* inchi-key:
 
* inchi-key:
** ovboqvaiymsudt-hrygcdposa-n
+
** jcavdwhqnftfbw-xrnrsjmdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 288.472
+
** 286.456
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7580]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.99.23-RXN]]
+
* [[RXN-5242]]
* [[RETINOLSAT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-13,14-dihydroretinol}}
+
{{#set: common-name=ent-kaurenal}}
{{#set: inchi-key=inchikey=ovboqvaiymsudt-hrygcdposa-n}}
+
{{#set: inchi-key=inchikey=jcavdwhqnftfbw-xrnrsjmdsa-n}}
{{#set: molecular-weight=288.472}}
+
{{#set: molecular-weight=286.456}}

Revision as of 11:14, 15 January 2021

Metabolite ENT-KAUR-16-EN-19-AL

  • common-name:
    • ent-kaurenal
  • smiles:
    • c=c1(c4(cc3(c1)(cc[ch]2(c(c)(c=o)cccc(c)2[ch]3cc4))))
  • inchi-key:
    • jcavdwhqnftfbw-xrnrsjmdsa-n
  • molecular-weight:
    • 286.456

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality