Difference between revisions of "MALONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21662 == * transcription-direction: ** negative * right-end-position: ** 245912 * left-end-position: ** 238885 * centisome-position: ** 21.117708...")
(Created page with "Category:metabolite == Metabolite MALONYL-COA == * common-name: ** malonyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21662 ==
+
== Metabolite MALONYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** malonyl-coa
−
* right-end-position:
+
* smiles:
−
** 245912
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 238885
+
** ltyoqgrjfjakna-dvvlenmvsa-i
−
* centisome-position:
+
* molecular-weight:
−
** 21.117708   
+
** 848.541
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
== Reaction(s) associated ==
+
* [[ACOACXr]]
−
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
+
* [[FATTY-ACID-SYNTHASE-RXN]]
−
** Category: [[annotation]]
+
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
−
* [[RXN-15117]]
+
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-10059]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-10734]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-12777]]
−
== Pathway(s) associated ==
+
* [[RXN-13294]]
−
* [[PWY-7817]]
+
* [[RXN-13295]]
−
** '''6''' reactions found over '''16''' reactions in the full pathway
+
* [[RXN-13296]]
−
{{#set: transcription-direction=negative}}
+
* [[RXN-13297]]
−
{{#set: right-end-position=245912}}
+
* [[RXN-13322]]
−
{{#set: left-end-position=238885}}
+
* [[RXN-13431]]
−
{{#set: centisome-position=21.117708    }}
+
* [[RXN-13441]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-14492]]
−
{{#set: nb reaction associated=2}}
+
* [[RXN-16016]]
−
{{#set: nb pathway associated=1}}
+
* [[RXN-16017]]
 +
* [[RXN-16094]]
 +
* [[RXN-16153]]
 +
* [[RXN-3142]]
 +
* [[RXN-7645]]
 +
* [[RXN-7697]]
 +
* [[RXN-9543]]
 +
* [[RXN-9632]]
 +
* [[RXN-9648]]
 +
* [[RXN-9650]]
 +
* [[RXN-9651]]
 +
* [[RXN-9652]]
 +
* [[RXN-9653]]
 +
* [[RXN-9654]]
 +
* [[RXN1G-368]]
 +
* [[RXN1G-445]]
 +
* [[RXN1G-499]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
* [[RXN0-5055]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=malonyl-coa}}
 +
{{#set: inchi-key=inchikey=ltyoqgrjfjakna-dvvlenmvsa-i}}
 +
{{#set: molecular-weight=848.541}}

Latest revision as of 11:11, 18 March 2021

Metabolite MALONYL-COA

  • common-name:
    • malonyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ltyoqgrjfjakna-dvvlenmvsa-i
  • molecular-weight:
    • 848.541

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MALONYL-COA&oldid=136926"