Difference between revisions of "MALTOPENTAOSE"

Revision as of 08:27, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE ==
+== Metabolite L-CYSTATHIONINE ==
 * common-name:
-** n-succinyl-l,l-2,6-diaminopimelate
+** l-cystathionine
 * smiles:
-** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
+** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
 * inchi-key:
-** glxuwzbupatpbr-bqbzgakwsa-l
+** ilrylpwnyfxemh-whfbiakzsa-n
 * molecular-weight:
-** 288.257
+** 222.259
 == Reaction(s) known to consume the compound ==
-* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+* [[CYSTATHIONASE-RXN]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+* [[O-SUCCHOMOSERLYASE-RXN]]
+* [[RXN-14048]]
+* [[RXN-15130]]
 == Reaction(s) known to produce the compound ==
-* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
+* [[CYSPH-RXN]]
+* [[CYSTATHIONASE-RXN]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+* [[O-SUCCHOMOSERLYASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}}
+{{#set: common-name=l-cystathionine}}
-{{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}}
+{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
-{{#set: molecular-weight=288.257}}
+{{#set: molecular-weight=222.259}}