Difference between revisions of "MALTOPENTAOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02445 == * transcription-direction: ** negative * right-end-position: ** 48420 * left-end-position: ** 46095 * centisome-position: ** 33.998127...")
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))c...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02445 ==
+
== Metabolite MALTOPENTAOSE ==
* transcription-direction:
+
* common-name:
** negative
+
** maltopentaose
* right-end-position:
+
* smiles:
** 48420
+
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
* left-end-position:
+
* inchi-key:
** 46095
+
** ftnipwxxignqqf-hzwihctqsa-n
* centisome-position:
+
* molecular-weight:
** 33.998127   
+
** 828.725
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14281]]
== Reaction(s) associated ==
+
* [[RXN-14284]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
* [[2.4.1.223-RXN]]
+
* [[RXN-14282]]
** Category: [[annotation]]
+
* [[RXN-14285]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[2.4.1.94-RXN]]
+
{{#set: common-name=maltopentaose}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=828.725}}
* [[3.1.3.16-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-11889]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-11890]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-15205]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-6558]]
 
** '''7''' reactions found over '''13''' reactions in the full pathway
 
* [[PWY-7437]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=48420}}
 
{{#set: left-end-position=46095}}
 
{{#set: centisome-position=33.998127    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=7}}
 
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite MALTOPENTAOSE

  • common-name:
    • maltopentaose
  • smiles:
    • c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
  • inchi-key:
    • ftnipwxxignqqf-hzwihctqsa-n
  • molecular-weight:
    • 828.725

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality