Difference between revisions of "MALTOPENTAOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: ** kdxkernsbixsrk-yfkpbyrvsa-o * molecular-weight:...")
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * smiles: ** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))c...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LYS ==
+
== Metabolite MALTOPENTAOSE ==
 
* common-name:
 
* common-name:
** l-lysine
+
** maltopentaose
 
* smiles:
 
* smiles:
** c([n+])cccc([n+])c([o-])=o
+
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
 
* inchi-key:
 
* inchi-key:
** kdxkernsbixsrk-yfkpbyrvsa-o
+
** ftnipwxxignqqf-hzwihctqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 147.197
+
** 828.725
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LYSINE--TRNA-LIGASE-RXN]]
+
* [[RXN-14281]]
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-14284]]
* [[RXN-1961]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMDECARB-RXN]]
+
* [[RXN-14282]]
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-14285]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-lysine}}
+
{{#set: common-name=maltopentaose}}
{{#set: inchi-key=inchikey=kdxkernsbixsrk-yfkpbyrvsa-o}}
+
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}
{{#set: molecular-weight=147.197}}
+
{{#set: molecular-weight=828.725}}

Latest revision as of 11:14, 18 March 2021

Metabolite MALTOPENTAOSE

  • common-name:
    • maltopentaose
  • smiles:
    • c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
  • inchi-key:
    • ftnipwxxignqqf-hzwihctqsa-n
  • molecular-weight:
    • 828.725

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality