Difference between revisions of "MALTOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-371 == * common-name: ** 1-octanal * smiles: ** ccccccc[ch]=o * inchi-key: ** nujgjrnetvairj-uhfffaoysa-n * molecular-weight: ** 128....")
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-371 ==
+
== Metabolite CPD-14925 ==
 
* common-name:
 
* common-name:
** 1-octanal
+
** (3z)-dec-3-enoyl-coa
 
* smiles:
 
* smiles:
** ccccccc[ch]=o
+
** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** nujgjrnetvairj-uhfffaoysa-n
+
** cqgvnmqhzqjnii-uusbzyposa-j
 
* molecular-weight:
 
* molecular-weight:
** 128.214
+
** 915.738
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R222-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17799]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-octanal}}
+
{{#set: common-name=(3z)-dec-3-enoyl-coa}}
{{#set: inchi-key=inchikey=nujgjrnetvairj-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}}
{{#set: molecular-weight=128.214}}
+
{{#set: molecular-weight=915.738}}

Revision as of 14:59, 5 January 2021

Metabolite CPD-14925

  • common-name:
    • (3z)-dec-3-enoyl-coa
  • smiles:
    • ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • cqgvnmqhzqjnii-uusbzyposa-j
  • molecular-weight:
    • 915.738

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality