Difference between revisions of "MALTOTRIOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AAL_LPAREN_fum_RPAREN_ AAL_LPAREN_fum_RPAREN_] == * direction: ** left-to-right * common-name: ** n...")
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * inchi-key:...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AAL_LPAREN_fum_RPAREN_ AAL_LPAREN_fum_RPAREN_] ==
+
== Metabolite MALTOTRIOSE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** n6-(1,2-dicarboxyethyl)amp amp-lyase (fumarate-forming)
+
** maltotriose
−
== Reaction formula ==
+
* smiles:
−
* 1.0 [[ADENYLOSUCC]][c] '''=>''' 1.0 [[AMP]][c] '''+''' 1.0 [[FUM]][c]
+
** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ06544]]
+
** fygdtmlnykfzsv-dzoucchmsa-n
−
** Category: [[orthology]]
+
* molecular-weight:
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 504.441
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
== Reconstruction information  ==
+
* [[RXN0-5183]]
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[RXN0-5182]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=n6-(1,2-dicarboxyethyl)amp amp-lyase (fumarate-forming)}}
+
{{#set: common-name=maltotriose}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}}
−
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=504.441}}
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite MALTOTRIOSE

  • common-name:
    • maltotriose
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
  • inchi-key:
    • fygdtmlnykfzsv-dzoucchmsa-n
  • molecular-weight:
    • 504.441

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MALTOTRIOSE&oldid=139584"