Difference between revisions of "MANNITOL-1P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Peptides-holder == * common-name: ** a peptide == Reaction(s) known to consume the compound == * 3.4.17.19-RXN * 3.4.17.21-RXN *...")
(Created page with "Category:metabolite == Metabolite CPD-659 == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o * inchi-key: ** mieildywganznh-dsquftab...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Peptides-holder ==
+
== Metabolite CPD-659 ==
 
* common-name:
 
* common-name:
** a peptide
+
** l-arogenate
 +
* smiles:
 +
** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
 +
* inchi-key:
 +
** mieildywganznh-dsquftabsa-m
 +
* molecular-weight:
 +
** 226.208
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.17.19-RXN]]
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
* [[3.4.17.21-RXN]]
+
* [[PREPHENATE-TRANSAMINE-RXN]]
* [[3.4.17.22-RXN]]
+
* [[RXN-5682]]
* [[3.6.3.43-RXN]]
 
* [[CARBOXYPEPTIDASE-A-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
* [[3.4.11.18-RXN]]
+
* [[PREPHENATE-TRANSAMINE-RXN]]
* [[3.4.11.2-RXN]]
 
* [[3.4.11.21-RXN]]
 
* [[3.4.11.5-RXN]]
 
* [[3.4.14.10-RXN]]
 
* [[3.4.14.5-RXN]]
 
* [[3.4.14.9-RXN]]
 
* [[3.4.16.2-RXN]]
 
* [[3.4.17.19-RXN]]
 
* [[3.4.17.21-RXN]]
 
* [[3.4.17.22-RXN]]
 
* [[3.4.18.1-RXN]]
 
* [[3.4.21.102-RXN]]
 
* [[3.4.21.112-RXN]]
 
* [[3.4.21.26-RXN]]
 
* [[3.4.21.4-RXN]]
 
* [[3.4.21.53-RXN]]
 
* [[3.4.21.83-RXN]]
 
* [[3.4.21.89-RXN]]
 
* [[3.4.21.92-RXN]]
 
* [[3.4.22.1-RXN]]
 
* [[3.4.22.15-RXN]]
 
* [[3.4.22.16-RXN]]
 
* [[3.4.22.34-RXN]]
 
* [[3.4.22.41-RXN]]
 
* [[3.4.23.1-RXN]]
 
* [[3.4.23.34-RXN]]
 
* [[3.4.23.5-RXN]]
 
* [[3.4.24.56-RXN]]
 
* [[3.4.24.57-RXN]]
 
* [[3.4.24.61-RXN]]
 
* [[3.4.24.64-RXN]]
 
* [[3.4.24.70-RXN]]
 
* [[3.4.25.1-RXN]]
 
* [[3.6.3.43-RXN]]
 
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
 
* [[CARBOXYPEPTIDASE-A-RXN]]
 
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
 
* [[RXN-11136]]
 
* [[RXN-11693]]
 
* [[RXN-11698]]
 
* [[RXN0-3201]]
 
* [[RXN0-5204]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a peptide}}
+
{{#set: common-name=l-arogenate}}
 +
{{#set: inchi-key=inchikey=mieildywganznh-dsquftabsa-m}}
 +
{{#set: molecular-weight=226.208}}

Revision as of 08:24, 15 March 2021

Metabolite CPD-659

  • common-name:
    • l-arogenate
  • smiles:
    • c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o
  • inchi-key:
    • mieildywganznh-dsquftabsa-m
  • molecular-weight:
    • 226.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality